C12H24N2 — CID 163469047
[(E,2R)-2,3-dimethyl-4-[(2S)-2-methylcyclopentyl]but-3-enyl]hydrazine (PubChem CID 163469047) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is [(E,2R)-2,3-dimethyl-4-[(2S)-2-methylcyclopentyl]but-3-enyl]hydrazine.
| Compound Name | [(E,2R)-2,3-dimethyl-4-[(2S)-2-methylcyclopentyl]but-3-enyl]hydrazine |
|---|---|
| PubChem CID | 163469047 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | [(E,2R)-2,3-dimethyl-4-[(2S)-2-methylcyclopentyl]but-3-enyl]hydrazine |
| SMILES | C/C(=C\C1CCC[C@@H]1C)[C@@H](C)CNN |
| InChI | InChI=1S/C12H24N2/c1-9-5-4-6-12(9)7-10(2)11(3)8-14-13/h7,9,11-12,14H,4-6,8,13H2,1-3H3/b10-7+/t9-,11-,12?/m0/s1 |
| InChIKey | BVBCBHNJPRFBJG-UPZFRZSSSA-N |
| XLogP | 2.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|