C8H9NO2 — CID 163469165
2-hydroxycyclohepta-1,4,6-triene-1-carboxamide (PubChem CID 163469165) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 2-hydroxycyclohepta-1,4,6-triene-1-carboxamide.
| Compound Name | 2-hydroxycyclohepta-1,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 163469165 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 2-hydroxycyclohepta-1,4,6-triene-1-carboxamide |
| SMILES | NC(=O)C1=C(O)CC=CC=C1 |
| InChI | InChI=1S/C8H9NO2/c9-8(11)6-4-2-1-3-5-7(6)10/h1-4,10H,5H2,(H2,9,11) |
| InChIKey | BVDGSSZAXVUWOO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |