C39H42F3IN4O9 — CID 163472847
N-[6-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]ethoxy]ethoxy]hexoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 163472847) has the molecular formula C39H42F3IN4O9 and a molecular weight of 894.68 g/mol. Its IUPAC name is N-[6-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]ethoxy]ethoxy]hexoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | N-[6-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]ethoxy]ethoxy]hexoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 163472847 |
| Molecular Formula | C39H42F3IN4O9 |
| Molecular Weight | 894.68 g/mol |
| Exact Mass | 894.19 |
| IUPAC Name | N-[6-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]ethoxy]ethoxy]hexoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CCCOCCOCCOCCCCCCONC(=O)c4ccc(F)c(F)c4Nc4ccc(I)cc4F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C39H42F3IN4O9/c40-28-12-11-27(35(34(28)42)44-30-13-10-25(43)23-29(30)41)36(49)46-56-18-4-2-1-3-16-53-19-21-55-22-20-54-17-6-8-24-7-5-9-26-33(24)39(52)47(38(26)51)31-14-15-32(48)45-37(31)50/h5,7,9-13,23,31,44H,1-4,6,8,14-22H2,(H,46,49)(H,45,48,50) |
| InChIKey | BXZOLTRKUYOVOA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|