C20H21IN2O4S — CID 163473656
1-(7-iodo-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-methoxy-4-phenylhexan-1-one (PubChem CID 163473656) has the molecular formula C20H21IN2O4S and a molecular weight of 512.37 g/mol. Its IUPAC name is 1-(7-iodo-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-methoxy-4-phenylhexan-1-one.
| Compound Name | 1-(7-iodo-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-methoxy-4-phenylhexan-1-one |
|---|---|
| PubChem CID | 163473656 |
| Molecular Formula | C20H21IN2O4S |
| Molecular Weight | 512.37 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | 1-(7-iodo-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-methoxy-4-phenylhexan-1-one |
| SMILES | COCCC(CCC(=O)C1=NS(=O)(=O)c2cc(I)ccc2N1)c1ccccc1 |
| InChI | InChI=1S/C20H21IN2O4S/c1-27-12-11-15(14-5-3-2-4-6-14)7-10-18(24)20-22-17-9-8-16(21)13-19(17)28(25,26)23-20/h2-6,8-9,13,15H,7,10-12H2,1H3,(H,22,23) |
| InChIKey | ICLZALGDEVZIAJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|