C20H24N4O4S — CID 166880332
N-[3-[(dimethylamino)methoxy]-2-phenylpropyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-3-carboxamide (PubChem CID 166880332) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[3-[(dimethylamino)methoxy]-2-phenylpropyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-3-carboxamide.
| Compound Name | N-[3-[(dimethylamino)methoxy]-2-phenylpropyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 166880332 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-[3-[(dimethylamino)methoxy]-2-phenylpropyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-3-carboxamide |
| SMILES | CN(C)COCC(CNC(=O)C1=NS(=O)(=O)c2ccccc2N1)c1ccccc1 |
| InChI | InChI=1S/C20H24N4O4S/c1-24(2)14-28-13-16(15-8-4-3-5-9-15)12-21-20(25)19-22-17-10-6-7-11-18(17)29(26,27)23-19/h3-11,16H,12-14H2,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | JBXOEIQPYFARKS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|