C17H26N4O3S — CID 50790631
N-[3-[butyl(ethyl)amino]propyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-3-carboxamide (PubChem CID 50790631) has the molecular formula C17H26N4O3S and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[3-[butyl(ethyl)amino]propyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-3-carboxamide.
| Compound Name | N-[3-[butyl(ethyl)amino]propyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 50790631 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[3-[butyl(ethyl)amino]propyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-3-carboxamide |
| SMILES | CCCCN(CC)CCCNC(=O)C1=NS(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C17H26N4O3S/c1-3-5-12-21(4-2)13-8-11-18-17(22)16-19-14-9-6-7-10-15(14)25(23,24)20-16/h6-7,9-10H,3-5,8,11-13H2,1-2H3,(H,18,22)(H,19,20) |
| InChIKey | PXOHZRWMINMCPS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|