C17H14ClIN2O4S — CID 163904192
4-(3-chlorophenyl)-4-hydroxy-1-(7-iodo-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)butan-1-one (PubChem CID 163904192) has the molecular formula C17H14ClIN2O4S and a molecular weight of 504.73 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-4-hydroxy-1-(7-iodo-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)butan-1-one.
| Compound Name | 4-(3-chlorophenyl)-4-hydroxy-1-(7-iodo-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)butan-1-one |
|---|---|
| PubChem CID | 163904192 |
| Molecular Formula | C17H14ClIN2O4S |
| Molecular Weight | 504.73 g/mol |
| Exact Mass | 503.94 |
| IUPAC Name | 4-(3-chlorophenyl)-4-hydroxy-1-(7-iodo-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)butan-1-one |
| SMILES | O=C(CCC(O)c1cccc(Cl)c1)C1=NS(=O)(=O)c2cc(I)ccc2N1 |
| InChI | InChI=1S/C17H14ClIN2O4S/c18-11-3-1-2-10(8-11)14(22)6-7-15(23)17-20-13-5-4-12(19)9-16(13)26(24,25)21-17/h1-5,8-9,14,22H,6-7H2,(H,20,21) |
| InChIKey | QMMCUEBEBRLLJA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.73 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|