C17H20ClN3O2 — CID 165044247
(1R)-1-(3-chlorophenyl)-1-hydroxy-7-(pyrimidin-2-ylamino)heptan-4-one (PubChem CID 165044247) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is (1R)-1-(3-chlorophenyl)-1-hydroxy-7-(pyrimidin-2-ylamino)heptan-4-one.
| Compound Name | (1R)-1-(3-chlorophenyl)-1-hydroxy-7-(pyrimidin-2-ylamino)heptan-4-one |
|---|---|
| PubChem CID | 165044247 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (1R)-1-(3-chlorophenyl)-1-hydroxy-7-(pyrimidin-2-ylamino)heptan-4-one |
| SMILES | O=C(CCCNc1ncccn1)CC[C@@H](O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H20ClN3O2/c18-14-5-1-4-13(12-14)16(23)8-7-15(22)6-2-9-19-17-20-10-3-11-21-17/h1,3-5,10-12,16,23H,2,6-9H2,(H,19,20,21)/t16-/m1/s1 |
| InChIKey | OQASIIKDXJNAOV-MRXNPFEDSA-N |
| XLogP | 3.40 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|