C24H20N2O5S — CID 163885959
3-(4,4-diphenylbutanoyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-7-carboxylic acid (PubChem CID 163885959) has the molecular formula C24H20N2O5S and a molecular weight of 448.50 g/mol. Its IUPAC name is 3-(4,4-diphenylbutanoyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-7-carboxylic acid.
| Compound Name | 3-(4,4-diphenylbutanoyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-7-carboxylic acid |
|---|---|
| PubChem CID | 163885959 |
| Molecular Formula | C24H20N2O5S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 3-(4,4-diphenylbutanoyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-7-carboxylic acid |
| SMILES | O=C(CCC(c1ccccc1)c1ccccc1)C1=NS(=O)(=O)c2cc(C(=O)O)ccc2N1 |
| InChI | InChI=1S/C24H20N2O5S/c27-21(14-12-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17)23-25-20-13-11-18(24(28)29)15-22(20)32(30,31)26-23/h1-11,13,15,19H,12,14H2,(H,25,26)(H,28,29) |
| InChIKey | QRZLNKXJZGRQJN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |