C16H18N2O4 — CID 163474346
3-[6-(3-hydroxyprop-1-ynyl)-3-oxo-4,5,6,7-tetrahydro-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 163474346) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-[6-(3-hydroxyprop-1-ynyl)-3-oxo-4,5,6,7-tetrahydro-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(3-hydroxyprop-1-ynyl)-3-oxo-4,5,6,7-tetrahydro-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 163474346 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3-[6-(3-hydroxyprop-1-ynyl)-3-oxo-4,5,6,7-tetrahydro-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2CC3=C(CCC(C#CCO)C3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C16H18N2O4/c19-7-1-2-10-3-4-12-11(8-10)9-18(16(12)22)13-5-6-14(20)17-15(13)21/h10,13,19H,3-9H2,(H,17,20,21) |
| InChIKey | BZEJYWXQZVYYIT-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|