C13H25NO6 — CID 163477548
(1R,2S,4R)-4-[(E,2S,3R)-2-amino-3-hydroxyhex-4-enoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 163477548) has the molecular formula C13H25NO6 and a molecular weight of 291.34 g/mol. Its IUPAC name is (1R,2S,4R)-4-[(E,2S,3R)-2-amino-3-hydroxyhex-4-enoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2S,4R)-4-[(E,2S,3R)-2-amino-3-hydroxyhex-4-enoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 163477548 |
| Molecular Formula | C13H25NO6 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | (1R,2S,4R)-4-[(E,2S,3R)-2-amino-3-hydroxyhex-4-enoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | C/C=C/[C@@H](O)[C@@H](N)CO[C@@H]1CC(CO)[C@@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C13H25NO6/c1-2-3-9(16)8(14)6-20-10-4-7(5-15)11(17)13(19)12(10)18/h2-3,7-13,15-19H,4-6,14H2,1H3/b3-2+/t7?,8-,9+,10+,11+,12?,13-/m0/s1 |
| InChIKey | CBSYCJHWPFGHSB-VFTCRGSQSA-N |
| XLogP | -2.27 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|