C15H30O5 — CID 10469479
(1R,2S,3R,4R,6R)-4-(hydroxymethyl)-6-octoxycyclohexane-1,2,3-triol (PubChem CID 10469479) has the molecular formula C15H30O5 and a molecular weight of 290.40 g/mol. Its IUPAC name is (1R,2S,3R,4R,6R)-4-(hydroxymethyl)-6-octoxycyclohexane-1,2,3-triol.
| Compound Name | (1R,2S,3R,4R,6R)-4-(hydroxymethyl)-6-octoxycyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 10469479 |
| Molecular Formula | C15H30O5 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (1R,2S,3R,4R,6R)-4-(hydroxymethyl)-6-octoxycyclohexane-1,2,3-triol |
| SMILES | CCCCCCCCOC1C[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H30O5/c1-2-3-4-5-6-7-8-20-12-9-11(10-16)13(17)15(19)14(12)18/h11-19H,2-10H2,1H3/t11-,12?,13-,14+,15+/m1/s1 |
| InChIKey | CJNUGJGXYVLNDO-OIYCOIKZSA-N |
| XLogP | 0.83 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|