C12H19NO5 — CID 162834255
2-methyl-4-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxybut-2-enenitrile (PubChem CID 162834255) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-methyl-4-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxybut-2-enenitrile.
| Compound Name | 2-methyl-4-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxybut-2-enenitrile |
|---|---|
| PubChem CID | 162834255 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-methyl-4-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxybut-2-enenitrile |
| SMILES | CC(C#N)=CCOC1CC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C12H19NO5/c1-7(5-13)2-3-18-9-4-8(6-14)10(15)12(17)11(9)16/h2,8-12,14-17H,3-4,6H2,1H3 |
| InChIKey | NGPFNHCBFQKUCE-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|