C16H27NO9 — CID 155120609
methyl (E,2S)-2-hydroxy-2-(methylcarbamoyl)-6-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyhex-4-enoate (PubChem CID 155120609) has the molecular formula C16H27NO9 and a molecular weight of 377.39 g/mol. Its IUPAC name is methyl (E,2S)-2-hydroxy-2-(methylcarbamoyl)-6-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyhex-4-enoate.
| Compound Name | methyl (E,2S)-2-hydroxy-2-(methylcarbamoyl)-6-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyhex-4-enoate |
|---|---|
| PubChem CID | 155120609 |
| Molecular Formula | C16H27NO9 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | methyl (E,2S)-2-hydroxy-2-(methylcarbamoyl)-6-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyhex-4-enoate |
| SMILES | CNC(=O)[C@@](O)(C/C=C/COC1CC(CO)C(O)C(O)C1O)C(=O)OC |
| InChI | InChI=1S/C16H27NO9/c1-17-14(22)16(24,15(23)25-2)5-3-4-6-26-10-7-9(8-18)11(19)13(21)12(10)20/h3-4,9-13,18-21,24H,5-8H2,1-2H3,(H,17,22)/b4-3+/t9?,10?,11?,12?,13?,16-/m0/s1 |
| InChIKey | CATRTFVEQQEPMA-MTRPRNFBSA-N |
| XLogP | -2.94 |
| TPSA | 165.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|