C26H39N7O5 — CID 163477753
2-[[6-amino-5-nitro-2-(oxolan-2-ylmethylamino)pyrimidin-4-yl]-[[3-(2-pyrrolidin-1-ylethyl)phenyl]methyl]amino]-1-ethoxyethanol (PubChem CID 163477753) has the molecular formula C26H39N7O5 and a molecular weight of 529.64 g/mol. Its IUPAC name is 2-[[6-amino-5-nitro-2-(oxolan-2-ylmethylamino)pyrimidin-4-yl]-[[3-(2-pyrrolidin-1-ylethyl)phenyl]methyl]amino]-1-ethoxyethanol.
| Compound Name | 2-[[6-amino-5-nitro-2-(oxolan-2-ylmethylamino)pyrimidin-4-yl]-[[3-(2-pyrrolidin-1-ylethyl)phenyl]methyl]amino]-1-ethoxyethanol |
|---|---|
| PubChem CID | 163477753 |
| Molecular Formula | C26H39N7O5 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | 2-[[6-amino-5-nitro-2-(oxolan-2-ylmethylamino)pyrimidin-4-yl]-[[3-(2-pyrrolidin-1-ylethyl)phenyl]methyl]amino]-1-ethoxyethanol |
| SMILES | CCOC(O)CN(Cc1cccc(CCN2CCCC2)c1)c1nc(NCC2CCCO2)nc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C26H39N7O5/c1-2-37-22(34)18-32(17-20-8-5-7-19(15-20)10-13-31-11-3-4-12-31)25-23(33(35)36)24(27)29-26(30-25)28-16-21-9-6-14-38-21/h5,7-8,15,21-22,34H,2-4,6,9-14,16-18H2,1H3,(H3,27,28,29,30) |
| InChIKey | CBXLAMDMIKREEU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|