C22H34N5O3- — CID 163481025
4-[2-[(3R)-1-[2-(4-cyclohexylpiperazin-1-yl)-2-oxoethyl]pyrrolidin-3-yl]-2-hydroxyhydrazinyl]phenolate (PubChem CID 163481025) has the molecular formula C22H34N5O3- and a molecular weight of 416.55 g/mol. Its IUPAC name is 4-[2-[(3R)-1-[2-(4-cyclohexylpiperazin-1-yl)-2-oxoethyl]pyrrolidin-3-yl]-2-hydroxyhydrazinyl]phenolate.
| Compound Name | 4-[2-[(3R)-1-[2-(4-cyclohexylpiperazin-1-yl)-2-oxoethyl]pyrrolidin-3-yl]-2-hydroxyhydrazinyl]phenolate |
|---|---|
| PubChem CID | 163481025 |
| Molecular Formula | C22H34N5O3- |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 4-[2-[(3R)-1-[2-(4-cyclohexylpiperazin-1-yl)-2-oxoethyl]pyrrolidin-3-yl]-2-hydroxyhydrazinyl]phenolate |
| SMILES | O=C(CN1CC[C@@H](N(O)Nc2ccc([O-])cc2)C1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C22H35N5O3/c28-21-8-6-18(7-9-21)23-27(30)20-10-11-24(16-20)17-22(29)26-14-12-25(13-15-26)19-4-2-1-3-5-19/h6-9,19-20,23,28,30H,1-5,10-17H2/p-1/t20-/m1/s1 |
| InChIKey | KWCSFCXLEHNDNB-HXUWFJFHSA-M |
| XLogP | 1.33 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|