C8H7BF2O6 — CID 163481126
2-(2,4-difluorophenyl)-1,3,2-dioxaborolane-4,4,5,5-tetrol (PubChem CID 163481126) has the molecular formula C8H7BF2O6 and a molecular weight of 247.95 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,3,2-dioxaborolane-4,4,5,5-tetrol.
| Compound Name | 2-(2,4-difluorophenyl)-1,3,2-dioxaborolane-4,4,5,5-tetrol |
|---|---|
| PubChem CID | 163481126 |
| Molecular Formula | C8H7BF2O6 |
| Molecular Weight | 247.95 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,3,2-dioxaborolane-4,4,5,5-tetrol |
| SMILES | OC1(O)OB(c2ccc(F)cc2F)OC1(O)O |
| InChI | InChI=1S/C8H7BF2O6/c10-4-1-2-5(6(11)3-4)9-16-7(12,13)8(14,15)17-9/h1-3,12-15H |
| InChIKey | CEPYERISMMMVJD-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.95 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|