About 3-amino-2-cyano-N'-methylbut-2-enimidamide
3-amino-2-cyano-N'-methylbut-2-enimidamide (PubChem CID 163481180) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-amino-2-cyano-N'-methylbut-2-enimidamide.
Molecular Properties
| Compound Name | 3-amino-2-cyano-N'-methylbut-2-enimidamide |
| PubChem CID | 163481180 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 3-amino-2-cyano-N'-methylbut-2-enimidamide |
| SMILES | C/N=C(\N)C(C#N)=C(C)N |
| InChI | InChI=1S/C6H10N4/c1-4(8)5(3-7)6(9)10-2/h8H2,1-2H3,(H2,9,10) |
| InChIKey | JKFVNVBWPGZVFB-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-cyano-N'-methylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-cyano-N'-methylbut-2-enimidamide?
The IUPAC name of 3-amino-2-cyano-N'-methylbut-2-enimidamide (CID 163481180) is 3-amino-2-cyano-N'-methylbut-2-enimidamide.
What is the SMILES notation for 3-amino-2-cyano-N'-methylbut-2-enimidamide?
The canonical SMILES for 3-amino-2-cyano-N'-methylbut-2-enimidamide is C/N=C(\N)C(C#N)=C(C)N.
What is the InChIKey of 3-amino-2-cyano-N'-methylbut-2-enimidamide?
The InChIKey is JKFVNVBWPGZVFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4/c1-4(8)5(3-7)6(9)10-2/h8H2,1-2H3,(H2,9,10).
What are the key properties of 3-amino-2-cyano-N'-methylbut-2-enimidamide?
3-amino-2-cyano-N'-methylbut-2-enimidamide has a molecular weight of 138.17 g/mol, XLogP of -0.27, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-cyano-N'-methylbut-2-enimidamide is sourced from PubChem (CID 163481180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).