C24H21ClN4O — CID 163481561
1-[3-(2-amino-5-phenyl-3H-pyrrol-4-yl)phenyl]-3-(3-chloro-4-methylphenyl)urea (PubChem CID 163481561) has the molecular formula C24H21ClN4O and a molecular weight of 416.91 g/mol. Its IUPAC name is 1-[3-(2-amino-5-phenyl-3H-pyrrol-4-yl)phenyl]-3-(3-chloro-4-methylphenyl)urea.
| Compound Name | 1-[3-(2-amino-5-phenyl-3H-pyrrol-4-yl)phenyl]-3-(3-chloro-4-methylphenyl)urea |
|---|---|
| PubChem CID | 163481561 |
| Molecular Formula | C24H21ClN4O |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 1-[3-(2-amino-5-phenyl-3H-pyrrol-4-yl)phenyl]-3-(3-chloro-4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cccc(C3=C(c4ccccc4)N=C(N)C3)c2)cc1Cl |
| InChI | InChI=1S/C24H21ClN4O/c1-15-10-11-19(13-21(15)25)28-24(30)27-18-9-5-8-17(12-18)20-14-22(26)29-23(20)16-6-3-2-4-7-16/h2-13H,14H2,1H3,(H2,26,29)(H2,27,28,30) |
| InChIKey | CEZFCRSLBZKHTN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|