C28H23N3 — CID 163483032
6-(4-methylphenyl)-4-phenyl-3-(4-phenylphenyl)-5H-1,2,4-triazine (PubChem CID 163483032) has the molecular formula C28H23N3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 6-(4-methylphenyl)-4-phenyl-3-(4-phenylphenyl)-5H-1,2,4-triazine.
| Compound Name | 6-(4-methylphenyl)-4-phenyl-3-(4-phenylphenyl)-5H-1,2,4-triazine |
|---|---|
| PubChem CID | 163483032 |
| Molecular Formula | C28H23N3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 6-(4-methylphenyl)-4-phenyl-3-(4-phenylphenyl)-5H-1,2,4-triazine |
| SMILES | Cc1ccc(C2=NN=C(c3ccc(-c4ccccc4)cc3)N(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C28H23N3/c1-21-12-14-24(15-13-21)27-20-31(26-10-6-3-7-11-26)28(30-29-27)25-18-16-23(17-19-25)22-8-4-2-5-9-22/h2-19H,20H2,1H3 |
| InChIKey | CGFCRNMANFORIA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |