C12H17FO3S — CID 163489041
2-[(4-fluorophenyl)sulfanylmethyl]-1-methoxybutane-1,2-diol (PubChem CID 163489041) has the molecular formula C12H17FO3S and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfanylmethyl]-1-methoxybutane-1,2-diol.
| Compound Name | 2-[(4-fluorophenyl)sulfanylmethyl]-1-methoxybutane-1,2-diol |
|---|---|
| PubChem CID | 163489041 |
| Molecular Formula | C12H17FO3S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfanylmethyl]-1-methoxybutane-1,2-diol |
| SMILES | CCC(O)(CSc1ccc(F)cc1)C(O)OC |
| InChI | InChI=1S/C12H17FO3S/c1-3-12(15,11(14)16-2)8-17-10-6-4-9(13)5-7-10/h4-7,11,14-15H,3,8H2,1-2H3 |
| InChIKey | CLAFLGVQNXBDQI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|