C11H15FO2S — CID 165440460
1-(1,1-dimethoxypropan-2-ylsulfanyl)-4-fluorobenzene (PubChem CID 165440460) has the molecular formula C11H15FO2S and a molecular weight of 230.30 g/mol. Its IUPAC name is 1-(1,1-dimethoxypropan-2-ylsulfanyl)-4-fluorobenzene.
| Compound Name | 1-(1,1-dimethoxypropan-2-ylsulfanyl)-4-fluorobenzene |
|---|---|
| PubChem CID | 165440460 |
| Molecular Formula | C11H15FO2S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-(1,1-dimethoxypropan-2-ylsulfanyl)-4-fluorobenzene |
| SMILES | COC(OC)C(C)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FO2S/c1-8(11(13-2)14-3)15-10-6-4-9(12)5-7-10/h4-8,11H,1-3H3 |
| InChIKey | HVNNXGRFMFLNCO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|