C38H55N4O3+ — CID 163490953
[2-[6-(3,3-dimethyl-1-propylindol-2-ylidene)-2-methyl-3-methylidenehex-4-en-2-yl]phenyl]-[6-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-6-oxohexyl]azanium (PubChem CID 163490953) has the molecular formula C38H55N4O3+ and a molecular weight of 615.88 g/mol. Its IUPAC name is [2-[6-(3,3-dimethyl-1-propylindol-2-ylidene)-2-methyl-3-methylidenehex-4-en-2-yl]phenyl]-[6-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-6-oxohexyl]azanium.
| Compound Name | [2-[6-(3,3-dimethyl-1-propylindol-2-ylidene)-2-methyl-3-methylidenehex-4-en-2-yl]phenyl]-[6-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-6-oxohexyl]azanium |
|---|---|
| PubChem CID | 163490953 |
| Molecular Formula | C38H55N4O3+ |
| Molecular Weight | 615.88 g/mol |
| Exact Mass | 615.43 |
| IUPAC Name | [2-[6-(3,3-dimethyl-1-propylindol-2-ylidene)-2-methyl-3-methylidenehex-4-en-2-yl]phenyl]-[6-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-6-oxohexyl]azanium |
| SMILES | C=C(C=CC=C1N(CCC)c2ccccc2C1(C)C)C(C)(C)c1ccccc1[NH2+]CCCCCC(=O)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H54N4O3/c1-10-27-42-32-23-16-14-21-30(32)38(8,9)33(42)24-18-19-28(2)37(6,7)29-20-13-15-22-31(29)39-26-17-11-12-25-34(43)40-41-35(44)45-36(3,4)5/h13-16,18-24,39H,2,10-12,17,25-27H2,1,3-9H3,(H,40,43)(H,41,44)/p+1 |
| InChIKey | CMOKEVNOXMUJBO-UHFFFAOYSA-O |
| XLogP | 7.48 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.88 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|