C20H36N4O6S — CID 163494649
5-[[6-amino-5-[(5-methylsulfanyl-5-oxopentanoyl)amino]-6-oxohexyl]amino]-5-oxo-2-(propan-2-ylamino)pentanoic acid (PubChem CID 163494649) has the molecular formula C20H36N4O6S and a molecular weight of 460.60 g/mol. Its IUPAC name is 5-[[6-amino-5-[(5-methylsulfanyl-5-oxopentanoyl)amino]-6-oxohexyl]amino]-5-oxo-2-(propan-2-ylamino)pentanoic acid.
| Compound Name | 5-[[6-amino-5-[(5-methylsulfanyl-5-oxopentanoyl)amino]-6-oxohexyl]amino]-5-oxo-2-(propan-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 163494649 |
| Molecular Formula | C20H36N4O6S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 5-[[6-amino-5-[(5-methylsulfanyl-5-oxopentanoyl)amino]-6-oxohexyl]amino]-5-oxo-2-(propan-2-ylamino)pentanoic acid |
| SMILES | CSC(=O)CCCC(=O)NC(CCCCNC(=O)CCC(NC(C)C)C(=O)O)C(N)=O |
| InChI | InChI=1S/C20H36N4O6S/c1-13(2)23-15(20(29)30)10-11-16(25)22-12-5-4-7-14(19(21)28)24-17(26)8-6-9-18(27)31-3/h13-15,23H,4-12H2,1-3H3,(H2,21,28)(H,22,25)(H,24,26)(H,29,30) |
| InChIKey | CPQMKGLKTVVCSI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 167.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|