C18H32FN3O5 — CID 177067624
(2R)-2-(carbonofluoridoylamino)-5-[[(5S)-7-methyl-6-oxo-5-(propan-2-ylamino)octyl]amino]-5-oxopentanoic acid (PubChem CID 177067624) has the molecular formula C18H32FN3O5 and a molecular weight of 389.47 g/mol. Its IUPAC name is (2R)-2-(carbonofluoridoylamino)-5-[[(5S)-7-methyl-6-oxo-5-(propan-2-ylamino)octyl]amino]-5-oxopentanoic acid.
| Compound Name | (2R)-2-(carbonofluoridoylamino)-5-[[(5S)-7-methyl-6-oxo-5-(propan-2-ylamino)octyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 177067624 |
| Molecular Formula | C18H32FN3O5 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | (2R)-2-(carbonofluoridoylamino)-5-[[(5S)-7-methyl-6-oxo-5-(propan-2-ylamino)octyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)N[C@@H](CCCCNC(=O)CC[C@@H](NC(=O)F)C(=O)O)C(=O)C(C)C |
| InChI | InChI=1S/C18H32FN3O5/c1-11(2)16(24)13(21-12(3)4)7-5-6-10-20-15(23)9-8-14(17(25)26)22-18(19)27/h11-14,21H,5-10H2,1-4H3,(H,20,23)(H,22,27)(H,25,26)/t13-,14+/m0/s1 |
| InChIKey | LAEQYWLOAUTTSG-UONOGXRCSA-N |
| XLogP | 1.78 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|