C23H41FN4O8 — CID 177067625
(2R)-2-(carbonofluoridoylamino)-5-[2-[2-[2-[[(4S)-6-methyl-5-oxo-4-(propan-2-ylamino)heptyl]amino]-2-oxoethoxy]ethoxy]ethylamino]-5-oxopentanoic acid (PubChem CID 177067625) has the molecular formula C23H41FN4O8 and a molecular weight of 520.60 g/mol. Its IUPAC name is (2R)-2-(carbonofluoridoylamino)-5-[2-[2-[2-[[(4S)-6-methyl-5-oxo-4-(propan-2-ylamino)heptyl]amino]-2-oxoethoxy]ethoxy]ethylamino]-5-oxopentanoic acid.
| Compound Name | (2R)-2-(carbonofluoridoylamino)-5-[2-[2-[2-[[(4S)-6-methyl-5-oxo-4-(propan-2-ylamino)heptyl]amino]-2-oxoethoxy]ethoxy]ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 177067625 |
| Molecular Formula | C23H41FN4O8 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | (2R)-2-(carbonofluoridoylamino)-5-[2-[2-[2-[[(4S)-6-methyl-5-oxo-4-(propan-2-ylamino)heptyl]amino]-2-oxoethoxy]ethoxy]ethylamino]-5-oxopentanoic acid |
| SMILES | CC(C)N[C@@H](CCCNC(=O)COCCOCCNC(=O)CC[C@@H](NC(=O)F)C(=O)O)C(=O)C(C)C |
| InChI | InChI=1S/C23H41FN4O8/c1-15(2)21(31)17(27-16(3)4)6-5-9-25-20(30)14-36-13-12-35-11-10-26-19(29)8-7-18(22(32)33)28-23(24)34/h15-18,27H,5-14H2,1-4H3,(H,25,30)(H,26,29)(H,28,34)(H,32,33)/t17-,18+/m0/s1 |
| InChIKey | HNBVBVVSYIJLIG-ZWKOTPCHSA-N |
| XLogP | 0.54 |
| TPSA | 172.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|