C12H21N3O4S — CID 163495069
4-amino-5-oxo-N-[(2S)-1-oxo-1-(2-oxopropylamino)-3-sulfanylpropan-2-yl]hexanamide (PubChem CID 163495069) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is 4-amino-5-oxo-N-[(2S)-1-oxo-1-(2-oxopropylamino)-3-sulfanylpropan-2-yl]hexanamide.
| Compound Name | 4-amino-5-oxo-N-[(2S)-1-oxo-1-(2-oxopropylamino)-3-sulfanylpropan-2-yl]hexanamide |
|---|---|
| PubChem CID | 163495069 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-amino-5-oxo-N-[(2S)-1-oxo-1-(2-oxopropylamino)-3-sulfanylpropan-2-yl]hexanamide |
| SMILES | CC(=O)CNC(=O)[C@@H](CS)NC(=O)CCC(N)C(C)=O |
| InChI | InChI=1S/C12H21N3O4S/c1-7(16)5-14-12(19)10(6-20)15-11(18)4-3-9(13)8(2)17/h9-10,20H,3-6,13H2,1-2H3,(H,14,19)(H,15,18)/t9?,10-/m1/s1 |
| InChIKey | CPZJDTYNEXERHF-QVDQXJPCSA-N |
| XLogP | -1.20 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|