C36H41NO13 — CID 163495361
cyclooct-2-en-1-yl N-[[3-hydroxy-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-2-yl]methyl]carbamate (PubChem CID 163495361) has the molecular formula C36H41NO13 and a molecular weight of 695.72 g/mol. Its IUPAC name is cyclooct-2-en-1-yl N-[[3-hydroxy-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-2-yl]methyl]carbamate.
| Compound Name | cyclooct-2-en-1-yl N-[[3-hydroxy-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 163495361 |
| Molecular Formula | C36H41NO13 |
| Molecular Weight | 695.72 g/mol |
| Exact Mass | 695.26 |
| IUPAC Name | cyclooct-2-en-1-yl N-[[3-hydroxy-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-2-yl]methyl]carbamate |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(=O)CO)C[C@@H]3OC1CCC(O)C(CNC(=O)OC2C=CCCCCC2)O1 |
| InChI | InChI=1S/C36H41NO13/c1-47-22-11-7-10-19-27(22)33(43)30-29(31(19)41)32(42)20-14-36(46,25(40)17-38)15-23(28(20)34(30)44)49-26-13-12-21(39)24(50-26)16-37-35(45)48-18-8-5-3-2-4-6-9-18/h5,7-8,10-11,18,21,23-24,26,38-39,42,44,46H,2-4,6,9,12-17H2,1H3,(H,37,45)/t18?,21?,23-,24?,26?,36-/m0/s1 |
| InChIKey | CQFSXIDVMDBCKA-LWPBAYAISA-N |
| XLogP | 2.66 |
| TPSA | 218.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.72 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|