C13H23NO3 — CID 163497088
N-[(4Z)-6-hydroxy-4-methylhepta-4,6-dienyl]-N-(2-methoxyethyl)acetamide (PubChem CID 163497088) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is N-[(4Z)-6-hydroxy-4-methylhepta-4,6-dienyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | N-[(4Z)-6-hydroxy-4-methylhepta-4,6-dienyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 163497088 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | N-[(4Z)-6-hydroxy-4-methylhepta-4,6-dienyl]-N-(2-methoxyethyl)acetamide |
| SMILES | C=C(O)/C=C(/C)CCCN(CCOC)C(C)=O |
| InChI | InChI=1S/C13H23NO3/c1-11(10-12(2)15)6-5-7-14(13(3)16)8-9-17-4/h10,15H,2,5-9H2,1,3-4H3/b11-10- |
| InChIKey | CRQGBFJWDINODI-KHPPLWFESA-N |
| XLogP | 2.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|