C19H18F2N10O8P2+2 — CID 163499603
9-[7-(6-aminopurin-9-yl)-16,17-difluoro-3,10-dioxo-2,4,6,9,11,14-hexaoxa-3,10-diphosphoniatricyclo[11.2.1.15,8]heptadecan-15-yl]purin-6-amine (PubChem CID 163499603) has the molecular formula C19H18F2N10O8P2+2 and a molecular weight of 614.36 g/mol. Its IUPAC name is 9-[7-(6-aminopurin-9-yl)-16,17-difluoro-3,10-dioxo-2,4,6,9,11,14-hexaoxa-3,10-diphosphoniatricyclo[11.2.1.15,8]heptadecan-15-yl]purin-6-amine.
| Compound Name | 9-[7-(6-aminopurin-9-yl)-16,17-difluoro-3,10-dioxo-2,4,6,9,11,14-hexaoxa-3,10-diphosphoniatricyclo[11.2.1.15,8]heptadecan-15-yl]purin-6-amine |
|---|---|
| PubChem CID | 163499603 |
| Molecular Formula | C19H18F2N10O8P2+2 |
| Molecular Weight | 614.36 g/mol |
| Exact Mass | 614.07 |
| IUPAC Name | 9-[7-(6-aminopurin-9-yl)-16,17-difluoro-3,10-dioxo-2,4,6,9,11,14-hexaoxa-3,10-diphosphoniatricyclo[11.2.1.15,8]heptadecan-15-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2C1OC2CO[P+](=O)OC3C(F)C(OC3n3cnc4c(N)ncnc43)O[P+](=O)OC1C2F |
| InChI | InChI=1S/C19H18F2N10O8P2/c20-7-6-1-34-40(32)37-12-8(21)19(36-18(12)31-5-29-10-14(23)25-3-27-16(10)31)39-41(33)38-11(7)17(35-6)30-4-28-9-13(22)24-2-26-15(9)30/h2-8,11-12,17-19H,1H2,(H2,22,24,26)(H2,23,25,27)/q+2 |
| InChIKey | MFODCAVOGAWMTO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 228.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|