C8H20N4 — CID 163501302
(E)-1-N-(2-aminoethyl)hex-1-ene-1,2,6-triamine (PubChem CID 163501302) has the molecular formula C8H20N4 and a molecular weight of 172.28 g/mol. Its IUPAC name is (E)-1-N-(2-aminoethyl)hex-1-ene-1,2,6-triamine.
| Compound Name | (E)-1-N-(2-aminoethyl)hex-1-ene-1,2,6-triamine |
|---|---|
| PubChem CID | 163501302 |
| Molecular Formula | C8H20N4 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | (E)-1-N-(2-aminoethyl)hex-1-ene-1,2,6-triamine |
| SMILES | NCCCC/C(N)=C\NCCN |
| InChI | InChI=1S/C8H20N4/c9-4-2-1-3-8(11)7-12-6-5-10/h7,12H,1-6,9-11H2/b8-7+ |
| InChIKey | CUZJLQAZQFPCQG-BQYQJAHWSA-N |
| XLogP | -0.54 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|