C10H21N3O — CID 177012831
6-[[(Z)-2,4-diaminobut-1-enyl]amino]hexanal (PubChem CID 177012831) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 6-[[(Z)-2,4-diaminobut-1-enyl]amino]hexanal.
| Compound Name | 6-[[(Z)-2,4-diaminobut-1-enyl]amino]hexanal |
|---|---|
| PubChem CID | 177012831 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 6-[[(Z)-2,4-diaminobut-1-enyl]amino]hexanal |
| SMILES | NCC/C(N)=C/NCCCCCC=O |
| InChI | InChI=1S/C10H21N3O/c11-6-5-10(12)9-13-7-3-1-2-4-8-14/h8-9,13H,1-7,11-12H2/b10-9- |
| InChIKey | BYXRQMLAIXROAQ-KTKRTIGZSA-N |
| XLogP | 0.48 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|