C19H16Cl2F3N5O — CID 163508759
3-chloro-N-[N-(3-chlorophenyl)-N'-[4-methyl-3-(trifluoromethyl)-2,3-dihydro-1H-pyrazol-5-yl]carbamimidoyl]benzamide (PubChem CID 163508759) has the molecular formula C19H16Cl2F3N5O and a molecular weight of 458.27 g/mol. Its IUPAC name is 3-chloro-N-[N-(3-chlorophenyl)-N'-[4-methyl-3-(trifluoromethyl)-2,3-dihydro-1H-pyrazol-5-yl]carbamimidoyl]benzamide.
| Compound Name | 3-chloro-N-[N-(3-chlorophenyl)-N'-[4-methyl-3-(trifluoromethyl)-2,3-dihydro-1H-pyrazol-5-yl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 163508759 |
| Molecular Formula | C19H16Cl2F3N5O |
| Molecular Weight | 458.27 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 3-chloro-N-[N-(3-chlorophenyl)-N'-[4-methyl-3-(trifluoromethyl)-2,3-dihydro-1H-pyrazol-5-yl]carbamimidoyl]benzamide |
| SMILES | CC1=C(N=C(NC(=O)c2cccc(Cl)c2)Nc2cccc(Cl)c2)NNC1C(F)(F)F |
| InChI | InChI=1S/C19H16Cl2F3N5O/c1-10-15(19(22,23)24)28-29-16(10)26-18(25-14-7-3-6-13(21)9-14)27-17(30)11-4-2-5-12(20)8-11/h2-9,15,28-29H,1H3,(H2,25,26,27,30) |
| InChIKey | DAVZUOVGTAQZMJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|