C23H17ClF3N5O2 — CID 135869989
3-chloro-N-[N-(2-oxo-3,4-dihydro-1H-quinoxalin-6-yl)-N'-[2-(trifluoromethyl)phenyl]carbamimidoyl]benzamide (PubChem CID 135869989) has the molecular formula C23H17ClF3N5O2 and a molecular weight of 487.87 g/mol. Its IUPAC name is 3-chloro-N-[N-(2-oxo-3,4-dihydro-1H-quinoxalin-6-yl)-N'-[2-(trifluoromethyl)phenyl]carbamimidoyl]benzamide.
| Compound Name | 3-chloro-N-[N-(2-oxo-3,4-dihydro-1H-quinoxalin-6-yl)-N'-[2-(trifluoromethyl)phenyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 135869989 |
| Molecular Formula | C23H17ClF3N5O2 |
| Molecular Weight | 487.87 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 3-chloro-N-[N-(2-oxo-3,4-dihydro-1H-quinoxalin-6-yl)-N'-[2-(trifluoromethyl)phenyl]carbamimidoyl]benzamide |
| SMILES | O=C1CNc2cc(N/C(=N/c3ccccc3C(F)(F)F)NC(=O)c3cccc(Cl)c3)ccc2N1 |
| InChI | InChI=1S/C23H17ClF3N5O2/c24-14-5-3-4-13(10-14)21(34)32-22(31-17-7-2-1-6-16(17)23(25,26)27)29-15-8-9-18-19(11-15)28-12-20(33)30-18/h1-11,28H,12H2,(H,30,33)(H2,29,31,32,34) |
| InChIKey | YXODQHCWWXYAGZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.87 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|