C17H22ClF2N5 — CID 163518460
2-[(2-fluorophenyl)methyl]-3,4-dihydropyrazol-5-amine;(2-fluorophenyl)methylhydrazine;hydrochloride (PubChem CID 163518460) has the molecular formula C17H22ClF2N5 and a molecular weight of 369.85 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl]-3,4-dihydropyrazol-5-amine;(2-fluorophenyl)methylhydrazine;hydrochloride.
| Compound Name | 2-[(2-fluorophenyl)methyl]-3,4-dihydropyrazol-5-amine;(2-fluorophenyl)methylhydrazine;hydrochloride |
|---|---|
| PubChem CID | 163518460 |
| Molecular Formula | C17H22ClF2N5 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl]-3,4-dihydropyrazol-5-amine;(2-fluorophenyl)methylhydrazine;hydrochloride |
| SMILES | Cl.NC1=NN(Cc2ccccc2F)CC1.NNCc1ccccc1F |
| InChI | InChI=1S/C10H12FN3.C7H9FN2.ClH/c11-9-4-2-1-3-8(9)7-14-6-5-10(12)13-14;8-7-4-2-1-3-6(7)5-10-9;/h1-4H,5-7H2,(H2,12,13);1-4,10H,5,9H2;1H |
| InChIKey | DITXRTCVAWYNEF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|