C10H15F3O2S — CID 163519225
3-(thian-4-yl)propyl 2,2,2-trifluoroacetate (PubChem CID 163519225) has the molecular formula C10H15F3O2S and a molecular weight of 256.29 g/mol. Its IUPAC name is 3-(thian-4-yl)propyl 2,2,2-trifluoroacetate.
| Compound Name | 3-(thian-4-yl)propyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 163519225 |
| Molecular Formula | C10H15F3O2S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-(thian-4-yl)propyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OCCCC1CCSCC1)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O2S/c11-10(12,13)9(14)15-5-1-2-8-3-6-16-7-4-8/h8H,1-7H2 |
| InChIKey | ULRQMDSPJGBVBG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|