C18H27NO5 — CID 163527147
N-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-hexoxybenzeneamine oxide (PubChem CID 163527147) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-hexoxybenzeneamine oxide.
| Compound Name | N-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-hexoxybenzeneamine oxide |
|---|---|
| PubChem CID | 163527147 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-hexoxybenzeneamine oxide |
| SMILES | CCCCCCOc1ccc([NH+]([O-])O[C@@H]2COC3CCOC32)cc1 |
| InChI | InChI=1S/C18H27NO5/c1-2-3-4-5-11-21-15-8-6-14(7-9-15)19(20)24-17-13-23-16-10-12-22-18(16)17/h6-9,16-19H,2-5,10-13H2,1H3/t16?,17-,18?/m1/s1 |
| InChIKey | DPTGDTBVGYUYRO-LXPRWKDFSA-N |
| XLogP | 2.15 |
| TPSA | 64.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|