C19H27O4P — CID 71051509
[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]phosphanyl-(4-hexoxyphenyl)methanone (PubChem CID 71051509) has the molecular formula C19H27O4P and a molecular weight of 350.40 g/mol. Its IUPAC name is [(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]phosphanyl-(4-hexoxyphenyl)methanone.
| Compound Name | [(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]phosphanyl-(4-hexoxyphenyl)methanone |
|---|---|
| PubChem CID | 71051509 |
| Molecular Formula | C19H27O4P |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]phosphanyl-(4-hexoxyphenyl)methanone |
| SMILES | CCCCCCOc1ccc(C(=O)P[C@@H]2CO[C@@H]3CCO[C@@H]32)cc1 |
| InChI | InChI=1S/C19H27O4P/c1-2-3-4-5-11-21-15-8-6-14(7-9-15)19(20)24-17-13-23-16-10-12-22-18(16)17/h6-9,16-18,24H,2-5,10-13H2,1H3/t16-,17-,18+/m1/s1 |
| InChIKey | QWZJWYKBBAPVKD-KURKYZTESA-N |
| XLogP | 4.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|