About [4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate
[4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate (PubChem CID 67902829) has the molecular formula C28H36O6
and a molecular weight of 468.59 g/mol. Its IUPAC name is [4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate.
Molecular Properties
| Compound Name | [4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate |
| PubChem CID | 67902829 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)c2ccc(OC(=O)O[C@@H]3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C28H36O6/c1-2-3-4-5-6-7-8-9-20-31-24-16-12-22(13-17-24)27(29)23-14-18-25(19-15-23)33-28(30)34-26-11-10-21-32-26/h12-19,26H,2-11,20-21H2,1H3/t26-/m1/s1 |
| InChIKey | NVQGLTUXRLYJML-AREMUKBSSA-N |
| XLogP | 7.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate?
The IUPAC name of [4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate (CID 67902829) is [4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate.
What is the SMILES notation for [4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate?
The canonical SMILES for [4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate is CCCCCCCCCCOc1ccc(C(=O)c2ccc(OC(=O)O[C@@H]3CCCO3)cc2)cc1.
What is the InChIKey of [4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate?
The InChIKey is NVQGLTUXRLYJML-AREMUKBSSA-N. The full InChI is InChI=1S/C28H36O6/c1-2-3-4-5-6-7-8-9-20-31-24-16-12-22(13-17-24)27(29)23-14-18-25(19-15-23)33-28(30)34-26-11-10-21-32-26/h12-19,26H,2-11,20-21H2,1H3/t26-/m1/s1.
What are the key properties of [4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate?
[4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate has a molecular weight of 468.59 g/mol, XLogP of 7.09, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-decoxybenzoyl)phenyl] [(2R)-oxolan-2-yl] carbonate is sourced from PubChem (CID 67902829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).