C22H25FINOS — CID 163528490
4-[1-[(3aR,5R,6aS)-5-(4-fluorophenyl)sulfanyl-3a-iodo-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]propan-2-yl]phenol (PubChem CID 163528490) has the molecular formula C22H25FINOS and a molecular weight of 497.42 g/mol. Its IUPAC name is 4-[1-[(3aR,5R,6aS)-5-(4-fluorophenyl)sulfanyl-3a-iodo-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]propan-2-yl]phenol.
| Compound Name | 4-[1-[(3aR,5R,6aS)-5-(4-fluorophenyl)sulfanyl-3a-iodo-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 163528490 |
| Molecular Formula | C22H25FINOS |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 4-[1-[(3aR,5R,6aS)-5-(4-fluorophenyl)sulfanyl-3a-iodo-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]propan-2-yl]phenol |
| SMILES | CC(CN1C[C@@H]2C[C@@H](Sc3ccc(F)cc3)C[C@]2(I)C1)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H25FINOS/c1-15(16-2-6-19(26)7-3-16)12-25-13-17-10-21(11-22(17,24)14-25)27-20-8-4-18(23)5-9-20/h2-9,15,17,21,26H,10-14H2,1H3/t15?,17-,21+,22-/m0/s1 |
| InChIKey | DQXBKBXHRIRDFI-JJZFXMTBSA-N |
| XLogP | 5.70 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|