C23H31NO5 — CID 163529812
N-[(E)-5-[5-[(2E,4E)-2,5-dimethyldeca-2,4-dienoyl]-4-hydroxy-6-oxopyran-2-yl]pent-1-enyl]formamide (PubChem CID 163529812) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is N-[(E)-5-[5-[(2E,4E)-2,5-dimethyldeca-2,4-dienoyl]-4-hydroxy-6-oxopyran-2-yl]pent-1-enyl]formamide.
| Compound Name | N-[(E)-5-[5-[(2E,4E)-2,5-dimethyldeca-2,4-dienoyl]-4-hydroxy-6-oxopyran-2-yl]pent-1-enyl]formamide |
|---|---|
| PubChem CID | 163529812 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | N-[(E)-5-[5-[(2E,4E)-2,5-dimethyldeca-2,4-dienoyl]-4-hydroxy-6-oxopyran-2-yl]pent-1-enyl]formamide |
| SMILES | CCCCC/C(C)=C/C=C(\C)C(=O)c1c(O)cc(CCC/C=C/NC=O)oc1=O |
| InChI | InChI=1S/C23H31NO5/c1-4-5-7-10-17(2)12-13-18(3)22(27)21-20(26)15-19(29-23(21)28)11-8-6-9-14-24-16-25/h9,12-16,26H,4-8,10-11H2,1-3H3,(H,24,25)/b14-9+,17-12+,18-13+ |
| InChIKey | DRYRTAXLQGCQQI-JNFDMQKLSA-N |
| XLogP | 4.58 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|