C25H31N3O3 — CID 163534525
(3Z,5R,7R)-7-(1,3-benzodioxol-5-yl)-3-[(Z)-but-2-enylidene]-2-methylidene-N-pentyl-4,5,6,7-tetrahydro-1H-pyrrolo[2,3-c]pyridine-5-carboxamide (PubChem CID 163534525) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is (3Z,5R,7R)-7-(1,3-benzodioxol-5-yl)-3-[(Z)-but-2-enylidene]-2-methylidene-N-pentyl-4,5,6,7-tetrahydro-1H-pyrrolo[2,3-c]pyridine-5-carboxamide.
| Compound Name | (3Z,5R,7R)-7-(1,3-benzodioxol-5-yl)-3-[(Z)-but-2-enylidene]-2-methylidene-N-pentyl-4,5,6,7-tetrahydro-1H-pyrrolo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 163534525 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (3Z,5R,7R)-7-(1,3-benzodioxol-5-yl)-3-[(Z)-but-2-enylidene]-2-methylidene-N-pentyl-4,5,6,7-tetrahydro-1H-pyrrolo[2,3-c]pyridine-5-carboxamide |
| SMILES | C=c1[nH]c2c(/c1=C/C=C\C)C[C@H](C(=O)NCCCCC)N[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H31N3O3/c1-4-6-8-12-26-25(29)20-14-19-18(9-7-5-2)16(3)27-24(19)23(28-20)17-10-11-21-22(13-17)31-15-30-21/h5,7,9-11,13,20,23,27-28H,3-4,6,8,12,14-15H2,1-2H3,(H,26,29)/b7-5-,18-9+/t20-,23-/m1/s1 |
| InChIKey | DVVAJVIYLCYQMI-MOBUFAHUSA-N |
| XLogP | 2.42 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|