C36H30N4 — CID 163537733
10-[3-[2,6-di(propan-2-yl)phenyl]-2H-imidazo[4,5-c]pyridin-3-ium-2-id-1-yl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaene (PubChem CID 163537733) has the molecular formula C36H30N4 and a molecular weight of 518.66 g/mol. Its IUPAC name is 10-[3-[2,6-di(propan-2-yl)phenyl]-2H-imidazo[4,5-c]pyridin-3-ium-2-id-1-yl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaene.
| Compound Name | 10-[3-[2,6-di(propan-2-yl)phenyl]-2H-imidazo[4,5-c]pyridin-3-ium-2-id-1-yl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaene |
|---|---|
| PubChem CID | 163537733 |
| Molecular Formula | C36H30N4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 10-[3-[2,6-di(propan-2-yl)phenyl]-2H-imidazo[4,5-c]pyridin-3-ium-2-id-1-yl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaene |
| SMILES | CC(C)c1cccc(C(C)C)c1-[n+]1[c-]n(-c2cc3c4ccccc4n4c5ccccc5c(c2)c34)c2ccncc21 |
| InChI | InChI=1S/C36H30N4/c1-22(2)25-12-9-13-26(23(3)4)35(25)39-21-38(33-16-17-37-20-34(33)39)24-18-29-27-10-5-7-14-31(27)40-32-15-8-6-11-28(32)30(19-24)36(29)40/h5-20,22-23H,1-4H3 |
| InChIKey | BCFWEBPMHRZQGE-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 26.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|