C24H19N3 — CID 164795913
5-(3-propan-2-yl-2H-imidazol-3-ium-2-id-1-yl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene (PubChem CID 164795913) has the molecular formula C24H19N3 and a molecular weight of 349.44 g/mol. Its IUPAC name is 5-(3-propan-2-yl-2H-imidazol-3-ium-2-id-1-yl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene.
| Compound Name | 5-(3-propan-2-yl-2H-imidazol-3-ium-2-id-1-yl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene |
|---|---|
| PubChem CID | 164795913 |
| Molecular Formula | C24H19N3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 5-(3-propan-2-yl-2H-imidazol-3-ium-2-id-1-yl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene |
| SMILES | CC(C)[n+]1[c-]n(-c2ccc3c(c2)c2cccc4c5ccccc5n3c42)cc1 |
| InChI | InChI=1S/C24H19N3/c1-16(2)25-12-13-26(15-25)17-10-11-23-21(14-17)20-8-5-7-19-18-6-3-4-9-22(18)27(23)24(19)20/h3-14,16H,1-2H3 |
| InChIKey | NBMIDZVHYGYJII-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 13.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|