C38H32IrN4+ — CID 164796210
CID 164796210 (PubChem CID 164796210) has the molecular formula C38H32IrN4+ and a molecular weight of 736.92 g/mol.
| Compound Name | CID 164796210 |
|---|---|
| PubChem CID | 164796210 |
| Molecular Formula | C38H32IrN4+ |
| Molecular Weight | 736.92 g/mol |
| Exact Mass | 737.23 |
| IUPAC Name | — |
| SMILES | CC(C)[n+]1[c-]n(-c2[c-]ccc3c4cccc5c6ccccc6n(c23)c54)cc1.Cc1c[c-]c(-c2cc(C)c(C)cn2)cc1.[Ir+3] |
| InChI | InChI=1S/C24H18N3.C14H14N.Ir/c1-16(2)25-13-14-26(15-25)22-12-6-10-20-19-9-5-8-18-17-7-3-4-11-21(17)27(23(18)19)24(20)22;1-10-4-6-13(7-5-10)14-8-11(2)12(3)9-15-14;/h3-11,13-14,16H,1-2H3;4-6,8-9H,1-3H3;/q2*-1;+3 |
| InChIKey | UHKMEVMBLFCZIS-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 26.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.92 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|