C54H53AuN3O+ — CID 168810985
1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazo[4,5-c]pyridin-1-ium-2-ide;gold(1+);tetraphenylen-2-ol (PubChem CID 168810985) has the molecular formula C54H53AuN3O+ and a molecular weight of 957.00 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazo[4,5-c]pyridin-1-ium-2-ide;gold(1+);tetraphenylen-2-ol.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazo[4,5-c]pyridin-1-ium-2-ide;gold(1+);tetraphenylen-2-ol |
|---|---|
| PubChem CID | 168810985 |
| Molecular Formula | C54H53AuN3O+ |
| Molecular Weight | 957.00 g/mol |
| Exact Mass | 956.38 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazo[4,5-c]pyridin-1-ium-2-ide;gold(1+);tetraphenylen-2-ol |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1[c-][n+](-c2c(C(C)C)cccc2C(C)C)c2ccncc21.Oc1ccc2c(c1)-c1ccccc1-c1ccccc1-c1ccccc1-2.[Au+] |
| InChI | InChI=1S/C30H37N3.C24H16O.Au/c1-19(2)23-11-9-12-24(20(3)4)29(23)32-18-33(28-17-31-16-15-27(28)32)30-25(21(5)6)13-10-14-26(30)22(7)8;25-16-13-14-23-21-11-4-3-9-19(21)17-7-1-2-8-18(17)20-10-5-6-12-22(20)24(23)15-16;/h9-17,19-22H,1-8H3;1-15,25H;/q;;+1/b;19-17-,20-18-,23-21-,24-22-; |
| InChIKey | IXEFSWKNWWPSGY-FLEJDQHBSA-N |
| XLogP | 13.97 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.00 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|