C47H51ClF5N2O3PS — CID 139168852
[5-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-3-ium-2-id-4-yl]-methyl-diphenylphosphanium;1,2-difluorobenzene;trifluoromethanesulfonate (PubChem CID 139168852) has the molecular formula C47H51ClF5N2O3PS and a molecular weight of 885.42 g/mol. Its IUPAC name is [5-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-3-ium-2-id-4-yl]-methyl-diphenylphosphanium;1,2-difluorobenzene;trifluoromethanesulfonate.
| Compound Name | [5-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-3-ium-2-id-4-yl]-methyl-diphenylphosphanium;1,2-difluorobenzene;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139168852 |
| Molecular Formula | C47H51ClF5N2O3PS |
| Molecular Weight | 885.42 g/mol |
| Exact Mass | 884.30 |
| IUPAC Name | [5-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-3-ium-2-id-4-yl]-methyl-diphenylphosphanium;1,2-difluorobenzene;trifluoromethanesulfonate |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1[c-][n+](-c2c(C(C)C)cccc2C(C)C)c([P+](C)(c2ccccc2)c2ccccc2)c1Cl.Fc1ccccc1F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C40H47ClN2P.C6H4F2.CHF3O3S/c1-27(2)33-22-16-23-34(28(3)4)37(33)42-26-43(38-35(29(5)6)24-17-25-36(38)30(7)8)40(39(42)41)44(9,31-18-12-10-13-19-31)32-20-14-11-15-21-32;7-5-3-1-2-4-6(5)8;2-1(3,4)8(5,6)7/h10-25,27-30H,1-9H3;1-4H;(H,5,6,7)/q+1;;/p-1 |
| InChIKey | UIINZFGNANRCFD-UHFFFAOYSA-M |
| XLogP | 11.64 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.42 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|