C39H44Cl2FN2P+2 — CID 139168855
[2,5-dichloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-4-yl]-fluoro-diphenylphosphanium (PubChem CID 139168855) has the molecular formula C39H44Cl2FN2P+2 and a molecular weight of 661.67 g/mol. Its IUPAC name is [2,5-dichloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-4-yl]-fluoro-diphenylphosphanium.
| Compound Name | [2,5-dichloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-4-yl]-fluoro-diphenylphosphanium |
|---|---|
| PubChem CID | 139168855 |
| Molecular Formula | C39H44Cl2FN2P+2 |
| Molecular Weight | 661.67 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | [2,5-dichloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-4-yl]-fluoro-diphenylphosphanium |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c([P+](F)(c2ccccc2)c2ccccc2)c(Cl)[n+](-c2c(C(C)C)cccc2C(C)C)c1Cl |
| InChI | InChI=1S/C39H44Cl2FN2P/c1-25(2)31-21-15-22-32(26(3)4)35(31)43-37(40)38(45(42,29-17-11-9-12-18-29)30-19-13-10-14-20-30)44(39(43)41)36-33(27(5)6)23-16-24-34(36)28(7)8/h9-28H,1-8H3/q+2 |
| InChIKey | ANUJJQPRNJRFLX-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.67 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|