About CID 177393324
CID 177393324 (PubChem CID 177393324) has the molecular formula C29H40B2N2
and a molecular weight of 438.28 g/mol.
Molecular Properties
| Compound Name | CID 177393324 |
| PubChem CID | 177393324 |
| Molecular Formula | C29H40B2N2 |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 438.34 |
| IUPAC Name | — |
| SMILES | [B][B-]c1n(-c2c(C(C)C)cccc2C(C)C)c(C)c(C)[n+]1-c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C29H40B2N2/c1-17(2)23-13-11-14-24(18(3)4)27(23)32-21(9)22(10)33(29(32)31-30)28-25(19(5)6)15-12-16-26(28)20(7)8/h11-20H,1-10H3 |
| InChIKey | ZAKWFQQWMIWHCN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 177393324 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177393324?
The IUPAC name of CID 177393324 (CID 177393324) is not available.
What is the SMILES notation for CID 177393324?
The canonical SMILES for CID 177393324 is [B][B-]c1n(-c2c(C(C)C)cccc2C(C)C)c(C)c(C)[n+]1-c1c(C(C)C)cccc1C(C)C.
What is the InChIKey of CID 177393324?
The InChIKey is ZAKWFQQWMIWHCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H40B2N2/c1-17(2)23-13-11-14-24(18(3)4)27(23)32-21(9)22(10)33(29(32)31-30)28-25(19(5)6)15-12-16-26(28)20(7)8/h11-20H,1-10H3.
What are the key properties of CID 177393324?
CID 177393324 has a molecular weight of 438.28 g/mol, XLogP of 6.28, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177393324 is sourced from PubChem (CID 177393324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).