C34H46N2S2 — CID 15319782
(2E)-3-[2,6-di(propan-2-yl)phenyl]-2-[3-[2,6-di(propan-2-yl)phenyl]-4,5-dimethyl-1,3-thiazol-2-ylidene]-4,5-dimethyl-1,3-thiazole (PubChem CID 15319782) has the molecular formula C34H46N2S2 and a molecular weight of 546.89 g/mol. Its IUPAC name is (2E)-3-[2,6-di(propan-2-yl)phenyl]-2-[3-[2,6-di(propan-2-yl)phenyl]-4,5-dimethyl-1,3-thiazol-2-ylidene]-4,5-dimethyl-1,3-thiazole.
| Compound Name | (2E)-3-[2,6-di(propan-2-yl)phenyl]-2-[3-[2,6-di(propan-2-yl)phenyl]-4,5-dimethyl-1,3-thiazol-2-ylidene]-4,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 15319782 |
| Molecular Formula | C34H46N2S2 |
| Molecular Weight | 546.89 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | (2E)-3-[2,6-di(propan-2-yl)phenyl]-2-[3-[2,6-di(propan-2-yl)phenyl]-4,5-dimethyl-1,3-thiazol-2-ylidene]-4,5-dimethyl-1,3-thiazole |
| SMILES | CC1=C(C)N(c2c(C(C)C)cccc2C(C)C)/C(=C2\SC(C)=C(C)N2c2c(C(C)C)cccc2C(C)C)S1 |
| InChI | InChI=1S/C34H46N2S2/c1-19(2)27-15-13-16-28(20(3)4)31(27)35-23(9)25(11)37-33(35)34-36(24(10)26(12)38-34)32-29(21(5)6)17-14-18-30(32)22(7)8/h13-22H,1-12H3/b34-33+ |
| InChIKey | IPQDDRQGRIFXIL-JEIPZWNWSA-N |
| XLogP | 11.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.89 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |